C10H13NO6S3 — CID 63617641
4-[(1,1-dioxothian-4-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 63617641) has the molecular formula C10H13NO6S3 and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-4-yl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(1,1-dioxothian-4-yl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 63617641 |
| Molecular Formula | C10H13NO6S3 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 4-[(1,1-dioxothian-4-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NC2CCS(=O)(=O)CC2)cs1 |
| InChI | InChI=1S/C10H13NO6S3/c12-10(13)9-5-8(6-18-9)20(16,17)11-7-1-3-19(14,15)4-2-7/h5-7,11H,1-4H2,(H,12,13) |
| InChIKey | SIXUMCLSVYAAJD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |