C12H18N2O4S2 — CID 120586279
methyl 4-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 120586279) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is methyl 4-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 4-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 120586279 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | methyl 4-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NC2CCNC(C)C2)cs1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-8-5-9(3-4-13-8)14-20(16,17)10-6-11(19-7-10)12(15)18-2/h6-9,13-14H,3-5H2,1-2H3 |
| InChIKey | LGEBUHFGJSILQJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |