C12H19ClN2O4S2 — CID 120585943
methyl 3-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate;hydrochloride (PubChem CID 120585943) has the molecular formula C12H19ClN2O4S2 and a molecular weight of 354.88 g/mol. Its IUPAC name is methyl 3-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate;hydrochloride.
| Compound Name | methyl 3-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 120585943 |
| Molecular Formula | C12H19ClN2O4S2 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | methyl 3-[(2-methylpiperidin-4-yl)sulfamoyl]thiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NC1CCNC(C)C1.Cl |
| InChI | InChI=1S/C12H18N2O4S2.ClH/c1-8-7-9(3-5-13-8)14-20(16,17)10-4-6-19-11(10)12(15)18-2;/h4,6,8-9,13-14H,3,5,7H2,1-2H3;1H |
| InChIKey | UXASGIJJDAYLJP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |