C12H16N2O4S2 — CID 114694295
methyl 3-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylate (PubChem CID 114694295) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl 3-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 114694295 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | methyl 3-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-18-12(15)11-10(4-7-19-11)20(16,17)14-8-9-2-5-13-6-3-9/h2,4,7,13-14H,3,5-6,8H2,1H3 |
| InChIKey | OEFYOOBAFZIVAH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|