C15H20N2O5S — CID 120721499
methyl 2-methoxy-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate (PubChem CID 120721499) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl 2-methoxy-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 2-methoxy-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 120721499 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | methyl 2-methoxy-4-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC2=CCNCC2)cc1OC |
| InChI | InChI=1S/C15H20N2O5S/c1-21-14-9-12(3-4-13(14)15(18)22-2)23(19,20)17-10-11-5-7-16-8-6-11/h3-5,9,16-17H,6-8,10H2,1-2H3 |
| InChIKey | UXUDDZFNYPQVLW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|