C13H18ClN3O5S — CID 120721848
4-methoxy-3-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride (PubChem CID 120721848) has the molecular formula C13H18ClN3O5S and a molecular weight of 363.82 g/mol. Its IUPAC name is 4-methoxy-3-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-methoxy-3-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721848 |
| Molecular Formula | C13H18ClN3O5S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-methoxy-3-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)NCC2=CCNCC2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H17N3O5S.ClH/c1-21-13-3-2-11(8-12(13)16(17)18)22(19,20)15-9-10-4-6-14-7-5-10;/h2-4,8,14-15H,5-7,9H2,1H3;1H |
| InChIKey | AWPTVRUPYIBWKS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|