C12H15Cl2N3O4S — CID 120721321
2-chloro-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride (PubChem CID 120721321) has the molecular formula C12H15Cl2N3O4S and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-chloro-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 2-chloro-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120721321 |
| Molecular Formula | C12H15Cl2N3O4S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 2-chloro-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cccc(Cl)c1S(=O)(=O)NCC1=CCNCC1 |
| InChI | InChI=1S/C12H14ClN3O4S.ClH/c13-10-2-1-3-11(16(17)18)12(10)21(19,20)15-8-9-4-6-14-7-5-9;/h1-4,14-15H,5-8H2;1H |
| InChIKey | WUMXSBKJQLCBAD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|