C13H17N3O2 — CID 114694729
2-methyl-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)aniline (PubChem CID 114694729) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-methyl-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)aniline.
| Compound Name | 2-methyl-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 114694729 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 2-methyl-6-nitro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)aniline |
| SMILES | Cc1cccc([N+](=O)[O-])c1NCC1=CCNCC1 |
| InChI | InChI=1S/C13H17N3O2/c1-10-3-2-4-12(16(17)18)13(10)15-9-11-5-7-14-8-6-11/h2-5,14-15H,6-9H2,1H3 |
| InChIKey | KDBFYAQRJSVSAC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|