C16H21N3O6S — CID 120721539
ethyl 2-methyl-3-nitro-5-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate (PubChem CID 120721539) has the molecular formula C16H21N3O6S and a molecular weight of 383.43 g/mol. Its IUPAC name is ethyl 2-methyl-3-nitro-5-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate.
| Compound Name | ethyl 2-methyl-3-nitro-5-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 120721539 |
| Molecular Formula | C16H21N3O6S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | ethyl 2-methyl-3-nitro-5-(1,2,3,6-tetrahydropyridin-4-ylmethylsulfamoyl)benzoate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)NCC2=CCNCC2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H21N3O6S/c1-3-25-16(20)14-8-13(9-15(11(14)2)19(21)22)26(23,24)18-10-12-4-6-17-7-5-12/h4,8-9,17-18H,3,5-7,10H2,1-2H3 |
| InChIKey | QSCQFQITQMTUTF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|