C15H22ClN3O6S — CID 119969759
ethyl 2-methyl-5-(2-methylpiperazin-1-yl)sulfonyl-3-nitrobenzoate;hydrochloride (PubChem CID 119969759) has the molecular formula C15H22ClN3O6S and a molecular weight of 407.88 g/mol. Its IUPAC name is ethyl 2-methyl-5-(2-methylpiperazin-1-yl)sulfonyl-3-nitrobenzoate;hydrochloride.
| Compound Name | ethyl 2-methyl-5-(2-methylpiperazin-1-yl)sulfonyl-3-nitrobenzoate;hydrochloride |
|---|---|
| PubChem CID | 119969759 |
| Molecular Formula | C15H22ClN3O6S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | ethyl 2-methyl-5-(2-methylpiperazin-1-yl)sulfonyl-3-nitrobenzoate;hydrochloride |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)N2CCNCC2C)cc([N+](=O)[O-])c1C.Cl |
| InChI | InChI=1S/C15H21N3O6S.ClH/c1-4-24-15(19)13-7-12(8-14(11(13)3)18(20)21)25(22,23)17-6-5-16-9-10(17)2;/h7-8,10,16H,4-6,9H2,1-3H3;1H |
| InChIKey | KFZNXHYCHHYDGV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|