C16H23N3O6S — CID 119977576
ethyl 2-methyl-5-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonyl-3-nitrobenzoate (PubChem CID 119977576) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is ethyl 2-methyl-5-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonyl-3-nitrobenzoate.
| Compound Name | ethyl 2-methyl-5-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 119977576 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl 2-methyl-5-[3-(methylaminomethyl)pyrrolidin-1-yl]sulfonyl-3-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)N2CCC(CNC)C2)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H23N3O6S/c1-4-25-16(20)14-7-13(8-15(11(14)2)19(21)22)26(23,24)18-6-5-12(10-18)9-17-3/h7-8,12,17H,4-6,9-10H2,1-3H3 |
| InChIKey | DBMBUBSHQNXJOV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|