C16H24ClN3O6S — CID 119979896
ethyl 2-methyl-5-[4-(methylamino)piperidin-1-yl]sulfonyl-3-nitrobenzoate;hydrochloride (PubChem CID 119979896) has the molecular formula C16H24ClN3O6S and a molecular weight of 421.90 g/mol. Its IUPAC name is ethyl 2-methyl-5-[4-(methylamino)piperidin-1-yl]sulfonyl-3-nitrobenzoate;hydrochloride.
| Compound Name | ethyl 2-methyl-5-[4-(methylamino)piperidin-1-yl]sulfonyl-3-nitrobenzoate;hydrochloride |
|---|---|
| PubChem CID | 119979896 |
| Molecular Formula | C16H24ClN3O6S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | ethyl 2-methyl-5-[4-(methylamino)piperidin-1-yl]sulfonyl-3-nitrobenzoate;hydrochloride |
| SMILES | CCOC(=O)c1cc(S(=O)(=O)N2CCC(NC)CC2)cc([N+](=O)[O-])c1C.Cl |
| InChI | InChI=1S/C16H23N3O6S.ClH/c1-4-25-16(20)14-9-13(10-15(11(14)2)19(21)22)26(23,24)18-7-5-12(17-3)6-8-18;/h9-10,12,17H,4-8H2,1-3H3;1H |
| InChIKey | YHKNNGATGKBXAU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|