C14H21ClN4O5S — CID 119491421
4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]-5-nitrobenzenesulfonamide;hydrochloride (PubChem CID 119491421) has the molecular formula C14H21ClN4O5S and a molecular weight of 392.87 g/mol. Its IUPAC name is 4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]-5-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | 4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]-5-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119491421 |
| Molecular Formula | C14H21ClN4O5S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-methyl-3-[3-(methylamino)piperidine-1-carbonyl]-5-nitrobenzenesulfonamide;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cc(S(N)(=O)=O)cc([N+](=O)[O-])c2C)C1.Cl |
| InChI | InChI=1S/C14H20N4O5S.ClH/c1-9-12(14(19)17-5-3-4-10(8-17)16-2)6-11(24(15,22)23)7-13(9)18(20)21;/h6-7,10,16H,3-5,8H2,1-2H3,(H2,15,22,23);1H |
| InChIKey | QHVLNWHJCOWHNN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|