C13H18BrN3O3S — CID 126768787
4-bromo-3-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide (PubChem CID 126768787) has the molecular formula C13H18BrN3O3S and a molecular weight of 376.28 g/mol. Its IUPAC name is 4-bromo-3-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide.
| Compound Name | 4-bromo-3-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126768787 |
| Molecular Formula | C13H18BrN3O3S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 4-bromo-3-[3-(methylamino)piperidine-1-carbonyl]benzenesulfonamide |
| SMILES | CNC1CCCN(C(=O)c2cc(S(N)(=O)=O)ccc2Br)C1 |
| InChI | InChI=1S/C13H18BrN3O3S/c1-16-9-3-2-6-17(8-9)13(18)11-7-10(21(15,19)20)4-5-12(11)14/h4-5,7,9,16H,2-3,6,8H2,1H3,(H2,15,19,20) |
| InChIKey | DFPPEGABEACZEV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |