C13H17BrN2O4S — CID 60729832
4-bromo-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 60729832) has the molecular formula C13H17BrN2O4S and a molecular weight of 377.26 g/mol. Its IUPAC name is 4-bromo-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | 4-bromo-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60729832 |
| Molecular Formula | C13H17BrN2O4S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 4-bromo-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | COC1CCN(C(=O)c2cc(S(N)(=O)=O)ccc2Br)CC1 |
| InChI | InChI=1S/C13H17BrN2O4S/c1-20-9-4-6-16(7-5-9)13(17)11-8-10(21(15,18)19)2-3-12(11)14/h2-3,8-9H,4-7H2,1H3,(H2,15,18,19) |
| InChIKey | JZOMZDTTYRQEAW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |