C13H17FN2O4S — CID 65388554
4-fluoro-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide (PubChem CID 65388554) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-fluoro-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide.
| Compound Name | 4-fluoro-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65388554 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 4-fluoro-3-(4-methoxypiperidine-1-carbonyl)benzenesulfonamide |
| SMILES | COC1CCN(C(=O)c2cc(S(N)(=O)=O)ccc2F)CC1 |
| InChI | InChI=1S/C13H17FN2O4S/c1-20-9-4-6-16(7-5-9)13(17)11-8-10(21(15,18)19)2-3-12(11)14/h2-3,8-9H,4-7H2,1H3,(H2,15,18,19) |
| InChIKey | PZVCFRVYYSCGGK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |