C14H17ClFNO3S — CID 65370983
3-(4-ethylpiperidine-1-carbonyl)-4-fluorobenzenesulfonyl chloride (PubChem CID 65370983) has the molecular formula C14H17ClFNO3S and a molecular weight of 333.81 g/mol. Its IUPAC name is 3-(4-ethylpiperidine-1-carbonyl)-4-fluorobenzenesulfonyl chloride.
| Compound Name | 3-(4-ethylpiperidine-1-carbonyl)-4-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65370983 |
| Molecular Formula | C14H17ClFNO3S |
| Molecular Weight | 333.81 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-(4-ethylpiperidine-1-carbonyl)-4-fluorobenzenesulfonyl chloride |
| SMILES | CCC1CCN(C(=O)c2cc(S(=O)(=O)Cl)ccc2F)CC1 |
| InChI | InChI=1S/C14H17ClFNO3S/c1-2-10-5-7-17(8-6-10)14(18)12-9-11(21(15,19)20)3-4-13(12)16/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | RRGCAORLHQIHGF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.81 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |