C14H17Cl2NO3S — CID 65397242
4-chloro-3-(4-methylazepane-1-carbonyl)benzenesulfonyl chloride (PubChem CID 65397242) has the molecular formula C14H17Cl2NO3S and a molecular weight of 350.27 g/mol. Its IUPAC name is 4-chloro-3-(4-methylazepane-1-carbonyl)benzenesulfonyl chloride.
| Compound Name | 4-chloro-3-(4-methylazepane-1-carbonyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65397242 |
| Molecular Formula | C14H17Cl2NO3S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 4-chloro-3-(4-methylazepane-1-carbonyl)benzenesulfonyl chloride |
| SMILES | CC1CCCN(C(=O)c2cc(S(=O)(=O)Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl2NO3S/c1-10-3-2-7-17(8-6-10)14(18)12-9-11(21(16,19)20)4-5-13(12)15/h4-5,9-10H,2-3,6-8H2,1H3 |
| InChIKey | OICYIJPOAPKOAA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |