C15H18ClN3O4 — CID 119487885
[3-(methylamino)piperidin-1-yl]-(5-nitro-1-benzofuran-2-yl)methanone;hydrochloride (PubChem CID 119487885) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-(5-nitro-1-benzofuran-2-yl)methanone;hydrochloride.
| Compound Name | [3-(methylamino)piperidin-1-yl]-(5-nitro-1-benzofuran-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119487885 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-(5-nitro-1-benzofuran-2-yl)methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2cc3cc([N+](=O)[O-])ccc3o2)C1.Cl |
| InChI | InChI=1S/C15H17N3O4.ClH/c1-16-11-3-2-6-17(9-11)15(19)14-8-10-7-12(18(20)21)4-5-13(10)22-14;/h4-5,7-8,11,16H,2-3,6,9H2,1H3;1H |
| InChIKey | PXQHTEUGJWBIIA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|