C11H16ClN3O4 — CID 119489082
[3-(methylamino)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone;hydrochloride (PubChem CID 119489082) has the molecular formula C11H16ClN3O4 and a molecular weight of 289.72 g/mol. Its IUPAC name is [3-(methylamino)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone;hydrochloride.
| Compound Name | [3-(methylamino)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119489082 |
| Molecular Formula | C11H16ClN3O4 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [3-(methylamino)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2ccc([N+](=O)[O-])o2)C1.Cl |
| InChI | InChI=1S/C11H15N3O4.ClH/c1-12-8-3-2-6-13(7-8)11(15)9-4-5-10(18-9)14(16)17;/h4-5,8,12H,2-3,6-7H2,1H3;1H |
| InChIKey | FCMCWMVGLUEFNV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|