C17H15N3O5 — CID 34738091
[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone (PubChem CID 34738091) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is [(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone.
| Compound Name | [(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone |
|---|---|
| PubChem CID | 34738091 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(5-nitrofuran-2-yl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N1CCC[C@H](c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C17H15N3O5/c21-17(14-7-8-15(24-14)20(22)23)19-9-3-4-11(10-19)16-18-12-5-1-2-6-13(12)25-16/h1-2,5-8,11H,3-4,9-10H2/t11-/m0/s1 |
| InChIKey | QVZUUIHUTPGVKU-NSHDSACASA-N |
| XLogP | 3.35 |
| TPSA | 102.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|