C22H20N4O2 — CID 51119873
[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(2-pyrazol-1-ylphenyl)methanone (PubChem CID 51119873) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is [3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(2-pyrazol-1-ylphenyl)methanone.
| Compound Name | [3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(2-pyrazol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 51119873 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(2-pyrazol-1-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-n1cccn1)N1CCCC(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C22H20N4O2/c27-22(17-8-1-3-10-19(17)26-14-6-12-23-26)25-13-5-7-16(15-25)21-24-18-9-2-4-11-20(18)28-21/h1-4,6,8-12,14,16H,5,7,13,15H2 |
| InChIKey | VIUJRMPAEUAVQK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |