C16H17N5O2 — CID 118792880
1-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(triazol-1-yl)ethanone (PubChem CID 118792880) has the molecular formula C16H17N5O2 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(triazol-1-yl)ethanone.
| Compound Name | 1-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 118792880 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-(triazol-1-yl)ethanone |
| SMILES | O=C(Cn1ccnn1)N1CCCC(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C16H17N5O2/c22-15(11-21-9-7-17-19-21)20-8-3-4-12(10-20)16-18-13-5-1-2-6-14(13)23-16/h1-2,5-7,9,12H,3-4,8,10-11H2 |
| InChIKey | YZIZDFZYZOQTHN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |