C18H22N4O3 — CID 37079341
4-[2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]acetyl]piperazin-2-one (PubChem CID 37079341) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]acetyl]piperazin-2-one.
| Compound Name | 4-[2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 37079341 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-[2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]acetyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)CN2CCC[C@H](c3nc4ccccc4o3)C2)CCN1 |
| InChI | InChI=1S/C18H22N4O3/c23-16-11-22(9-7-19-16)17(24)12-21-8-3-4-13(10-21)18-20-14-5-1-2-6-15(14)25-18/h1-2,5-6,13H,3-4,7-12H2,(H,19,23)/t13-/m0/s1 |
| InChIKey | ZKKASBZIZUFKCZ-ZDUSSCGKSA-N |
| XLogP | 0.97 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |