C25H31N3O2 — CID 31988858
2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-N-benzyl-N-tert-butylacetamide (PubChem CID 31988858) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-N-benzyl-N-tert-butylacetamide.
| Compound Name | 2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-N-benzyl-N-tert-butylacetamide |
|---|---|
| PubChem CID | 31988858 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-N-benzyl-N-tert-butylacetamide |
| SMILES | CC(C)(C)N(Cc1ccccc1)C(=O)CN1CCC[C@H](c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C25H31N3O2/c1-25(2,3)28(16-19-10-5-4-6-11-19)23(29)18-27-15-9-12-20(17-27)24-26-21-13-7-8-14-22(21)30-24/h4-8,10-11,13-14,20H,9,12,15-18H2,1-3H3/t20-/m0/s1 |
| InChIKey | GSHUHTASDYWEGB-FQEVSTJZSA-N |
| XLogP | 4.83 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |