C16H18N2O3 — CID 37080640
(3S)-3-[(3R)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]oxolan-2-one (PubChem CID 37080640) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is (3S)-3-[(3R)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]oxolan-2-one.
| Compound Name | (3S)-3-[(3R)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]oxolan-2-one |
|---|---|
| PubChem CID | 37080640 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (3S)-3-[(3R)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]oxolan-2-one |
| SMILES | O=C1OCC[C@@H]1N1CCC[C@@H](c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C16H18N2O3/c19-16-13(7-9-20-16)18-8-3-4-11(10-18)15-17-12-5-1-2-6-14(12)21-15/h1-2,5-6,11,13H,3-4,7-10H2/t11-,13+/m1/s1 |
| InChIKey | XNCCEZDVLXBSEU-YPMHNXCESA-N |
| XLogP | 2.32 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |