C16H20N2O4S — CID 98788058
(3S,4R)-4-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 98788058) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is (3S,4R)-4-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4R)-4-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 98788058 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (3S,4R)-4-[(3S)-3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@@H](N2CCC[C@H](c3nc4ccccc4o3)C2)C1 |
| InChI | InChI=1S/C16H20N2O4S/c19-14-10-23(20,21)9-13(14)18-7-3-4-11(8-18)16-17-12-5-1-2-6-15(12)22-16/h1-2,5-6,11,13-14,19H,3-4,7-10H2/t11-,13-,14+/m0/s1 |
| InChIKey | SQXHOMPJVXJTTD-FPMFFAJLSA-N |
| XLogP | 1.17 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |