C19H17ClN2O2 — CID 42957516
[3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(3-chlorophenyl)methanone (PubChem CID 42957516) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is [3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(3-chlorophenyl)methanone.
| Compound Name | [3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 42957516 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [3-(1,3-benzoxazol-2-yl)piperidin-1-yl]-(3-chlorophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCCC(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C19H17ClN2O2/c20-15-7-3-5-13(11-15)19(23)22-10-4-6-14(12-22)18-21-16-8-1-2-9-17(16)24-18/h1-3,5,7-9,11,14H,4,6,10,12H2 |
| InChIKey | RKQWXDMEEFEXIA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |