C21H18N4O3S — CID 55719034
7-[3-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 55719034) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 7-[3-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[3-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 55719034 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 7-[3-(1,3-benzoxazol-2-yl)piperidine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=C(c1ccc2c(=O)[nH]c(=S)[nH]c2c1)N1CCCC(c2nc3ccccc3o2)C1 |
| InChI | InChI=1S/C21H18N4O3S/c26-18-14-8-7-12(10-16(14)23-21(29)24-18)20(27)25-9-3-4-13(11-25)19-22-15-5-1-2-6-17(15)28-19/h1-2,5-8,10,13H,3-4,9,11H2,(H2,23,24,26,29) |
| InChIKey | VSRXHQPAXNSDAF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|