C22H27N3O2 — CID 131902815
2-[1-[1-(furan-2-ylmethyl)piperidin-4-yl]piperidin-3-yl]-1,3-benzoxazole (PubChem CID 131902815) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 2-[1-[1-(furan-2-ylmethyl)piperidin-4-yl]piperidin-3-yl]-1,3-benzoxazole.
| Compound Name | 2-[1-[1-(furan-2-ylmethyl)piperidin-4-yl]piperidin-3-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 131902815 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 2-[1-[1-(furan-2-ylmethyl)piperidin-4-yl]piperidin-3-yl]-1,3-benzoxazole |
| SMILES | c1coc(CN2CCC(N3CCCC(c4nc5ccccc5o4)C3)CC2)c1 |
| InChI | InChI=1S/C22H27N3O2/c1-2-8-21-20(7-1)23-22(27-21)17-5-3-11-25(15-17)18-9-12-24(13-10-18)16-19-6-4-14-26-19/h1-2,4,6-8,14,17-18H,3,5,9-13,15-16H2 |
| InChIKey | WARSSMVJDPITJC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 45.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |