C13H21ClN2O3 — CID 119488456
[5-(methoxymethyl)furan-2-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride (PubChem CID 119488456) has the molecular formula C13H21ClN2O3 and a molecular weight of 288.77 g/mol. Its IUPAC name is [5-(methoxymethyl)furan-2-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride.
| Compound Name | [5-(methoxymethyl)furan-2-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119488456 |
| Molecular Formula | C13H21ClN2O3 |
| Molecular Weight | 288.77 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [5-(methoxymethyl)furan-2-yl]-[3-(methylamino)piperidin-1-yl]methanone;hydrochloride |
| SMILES | CNC1CCCN(C(=O)c2ccc(COC)o2)C1.Cl |
| InChI | InChI=1S/C13H20N2O3.ClH/c1-14-10-4-3-7-15(8-10)13(16)12-6-5-11(18-12)9-17-2;/h5-6,10,14H,3-4,7-9H2,1-2H3;1H |
| InChIKey | ABFRUTQXAYWMLH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.77 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |