C18H22N2O4 — CID 70711514
[5-(methoxymethyl)furan-2-yl]-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]methanone (PubChem CID 70711514) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is [5-(methoxymethyl)furan-2-yl]-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]methanone.
| Compound Name | [5-(methoxymethyl)furan-2-yl]-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70711514 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [5-(methoxymethyl)furan-2-yl]-[3-(pyridin-2-ylmethoxy)piperidin-1-yl]methanone |
| SMILES | COCc1ccc(C(=O)N2CCCC(OCc3ccccn3)C2)o1 |
| InChI | InChI=1S/C18H22N2O4/c1-22-13-16-7-8-17(24-16)18(21)20-10-4-6-15(11-20)23-12-14-5-2-3-9-19-14/h2-3,5,7-9,15H,4,6,10-13H2,1H3 |
| InChIKey | BYNAHGRUCAAJGM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |