C20H25NO3 — CID 26333907
[5-(methoxymethyl)furan-2-yl]-[(3R)-3-(2-phenylethyl)piperidin-1-yl]methanone (PubChem CID 26333907) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is [5-(methoxymethyl)furan-2-yl]-[(3R)-3-(2-phenylethyl)piperidin-1-yl]methanone.
| Compound Name | [5-(methoxymethyl)furan-2-yl]-[(3R)-3-(2-phenylethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 26333907 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [5-(methoxymethyl)furan-2-yl]-[(3R)-3-(2-phenylethyl)piperidin-1-yl]methanone |
| SMILES | COCc1ccc(C(=O)N2CCC[C@@H](CCc3ccccc3)C2)o1 |
| InChI | InChI=1S/C20H25NO3/c1-23-15-18-11-12-19(24-18)20(22)21-13-5-8-17(14-21)10-9-16-6-3-2-4-7-16/h2-4,6-7,11-12,17H,5,8-10,13-15H2,1H3/t17-/m0/s1 |
| InChIKey | AACIVLIEZCTXTI-KRWDZBQOSA-N |
| XLogP | 3.91 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |