C19H21NO6 — CID 125415613
(3R)-1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid (PubChem CID 125415613) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is (3R)-1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 125415613 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (3R)-1-[5-[(2-methoxyphenoxy)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccccc1OCc1ccc(C(=O)N2CCC[C@@H](C(=O)O)C2)o1 |
| InChI | InChI=1S/C19H21NO6/c1-24-15-6-2-3-7-16(15)25-12-14-8-9-17(26-14)18(21)20-10-4-5-13(11-20)19(22)23/h2-3,6-9,13H,4-5,10-12H2,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | KFJGPFLGTPWDMB-CYBMUJFWSA-N |
| XLogP | 2.80 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |