C17H18N2O5 — CID 124703095
(3S)-1-[5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid (PubChem CID 124703095) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is (3S)-1-[5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124703095 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (3S)-1-[5-[(2-oxo-1-pyridinyl)methyl]furan-2-carbonyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(C(=O)c2ccc(Cn3ccccc3=O)o2)C1 |
| InChI | InChI=1S/C17H18N2O5/c20-15-5-1-2-8-18(15)11-13-6-7-14(24-13)16(21)19-9-3-4-12(10-19)17(22)23/h1-2,5-8,12H,3-4,9-11H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | NAKOZWBYIQESCD-LBPRGKRZSA-N |
| XLogP | 1.43 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |