C19H20N2O3 — CID 47051145
2-[[5-(azepane-1-carbonyl)furan-2-yl]methoxy]benzonitrile (PubChem CID 47051145) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[[5-(azepane-1-carbonyl)furan-2-yl]methoxy]benzonitrile.
| Compound Name | 2-[[5-(azepane-1-carbonyl)furan-2-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 47051145 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[[5-(azepane-1-carbonyl)furan-2-yl]methoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCc1ccc(C(=O)N2CCCCCC2)o1 |
| InChI | InChI=1S/C19H20N2O3/c20-13-15-7-3-4-8-17(15)23-14-16-9-10-18(24-16)19(22)21-11-5-1-2-6-12-21/h3-4,7-10H,1-2,5-6,11-12,14H2 |
| InChIKey | PZFIXXBGCALBII-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |