C19H20N2O4 — CID 56814629
5-[(2-cyanophenoxy)methyl]-N-(4-hydroxycyclohexyl)furan-2-carboxamide (PubChem CID 56814629) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-(4-hydroxycyclohexyl)furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-(4-hydroxycyclohexyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 56814629 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-(4-hydroxycyclohexyl)furan-2-carboxamide |
| SMILES | N#Cc1ccccc1OCc1ccc(C(=O)NC2CCC(O)CC2)o1 |
| InChI | InChI=1S/C19H20N2O4/c20-11-13-3-1-2-4-17(13)24-12-16-9-10-18(25-16)19(23)21-14-5-7-15(22)8-6-14/h1-4,9-10,14-15,22H,5-8,12H2,(H,21,23) |
| InChIKey | UDXBHEVYESXPTE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |