C21H24N2O4 — CID 95783263
5-[(2-cyanophenoxy)methyl]-N-[(2R)-2-cyclopentyl-2-hydroxypropyl]furan-2-carboxamide (PubChem CID 95783263) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-[(2R)-2-cyclopentyl-2-hydroxypropyl]furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-[(2R)-2-cyclopentyl-2-hydroxypropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95783263 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-[(2R)-2-cyclopentyl-2-hydroxypropyl]furan-2-carboxamide |
| SMILES | C[C@](O)(CNC(=O)c1ccc(COc2ccccc2C#N)o1)C1CCCC1 |
| InChI | InChI=1S/C21H24N2O4/c1-21(25,16-7-3-4-8-16)14-23-20(24)19-11-10-17(27-19)13-26-18-9-5-2-6-15(18)12-22/h2,5-6,9-11,16,25H,3-4,7-8,13-14H2,1H3,(H,23,24)/t21-/m0/s1 |
| InChIKey | DPSVQNQJAYQLRB-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 95.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |