C23H27N3O5 — CID 55980089
5-[(2-cyanophenoxy)methyl]-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]furan-2-carboxamide (PubChem CID 55980089) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55980089 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]furan-2-carboxamide |
| SMILES | N#Cc1ccccc1OCc1ccc(C(=O)NCC(C2CCOC2)N2CCOCC2)o1 |
| InChI | InChI=1S/C23H27N3O5/c24-13-17-3-1-2-4-21(17)30-16-19-5-6-22(31-19)23(27)25-14-20(18-7-10-29-15-18)26-8-11-28-12-9-26/h1-6,18,20H,7-12,14-16H2,(H,25,27) |
| InChIKey | XQBHWSSQRGUGIT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |