C21H25N3O3 — CID 55873591
5-[(2-cyanophenoxy)methyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]furan-2-carboxamide (PubChem CID 55873591) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55873591 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]furan-2-carboxamide |
| SMILES | CC1CCCCN1CCNC(=O)c1ccc(COc2ccccc2C#N)o1 |
| InChI | InChI=1S/C21H25N3O3/c1-16-6-4-5-12-24(16)13-11-23-21(25)20-10-9-18(27-20)15-26-19-8-3-2-7-17(19)14-22/h2-3,7-10,16H,4-6,11-13,15H2,1H3,(H,23,25) |
| InChIKey | QEWPSPUHBALERI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |