C24H23N3O4 — CID 55843016
5-[(2-cyanophenoxy)methyl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 55843016) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55843016 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-[(2-cyclopentyloxy-3-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | N#Cc1ccccc1OCc1ccc(C(=O)NCc2cccnc2OC2CCCC2)o1 |
| InChI | InChI=1S/C24H23N3O4/c25-14-17-6-1-4-10-21(17)29-16-20-11-12-22(30-20)23(28)27-15-18-7-5-13-26-24(18)31-19-8-2-3-9-19/h1,4-7,10-13,19H,2-3,8-9,15-16H2,(H,27,28) |
| InChIKey | NSYARJGLUHDLFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |