C22H23N3O4 — CID 47029190
N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 47029190) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47029190 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[(2-cyclopentyloxy-3-pyridinyl)methyl]-5-[(2-oxo-1-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1cccnc1OC1CCCC1)c1ccc(Cn2ccccc2=O)o1 |
| InChI | InChI=1S/C22H23N3O4/c26-20-9-3-4-13-25(20)15-18-10-11-19(28-18)21(27)24-14-16-6-5-12-23-22(16)29-17-7-1-2-8-17/h3-6,9-13,17H,1-2,7-8,14-15H2,(H,24,27) |
| InChIKey | GUQGYCWXMUNWNT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |