C19H15N3O3 — CID 51085773
5-[(2-cyanophenoxy)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide (PubChem CID 51085773) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 5-[(2-cyanophenoxy)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide.
| Compound Name | 5-[(2-cyanophenoxy)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 51085773 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-[(2-cyanophenoxy)methyl]-N-(pyridin-3-ylmethyl)furan-2-carboxamide |
| SMILES | N#Cc1ccccc1OCc1ccc(C(=O)NCc2cccnc2)o1 |
| InChI | InChI=1S/C19H15N3O3/c20-10-15-5-1-2-6-17(15)24-13-16-7-8-18(25-16)19(23)22-12-14-4-3-9-21-11-14/h1-9,11H,12-13H2,(H,22,23) |
| InChIKey | IUEDXAAPNWHTII-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |