C25H33N3O5 — CID 55682964
3-ethoxy-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 55682964) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-ethoxy-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | 3-ethoxy-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55682964 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 3-ethoxy-N-[2-morpholin-4-yl-2-(oxolan-3-yl)ethyl]-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCC(C2CCOC2)N2CCOCC2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C25H33N3O5/c1-2-32-24-14-20(5-6-23(24)33-17-19-4-3-8-26-15-19)25(29)27-16-22(21-7-11-31-18-21)28-9-12-30-13-10-28/h3-6,8,14-15,21-22H,2,7,9-13,16-18H2,1H3,(H,27,29) |
| InChIKey | UQSUTNVTQYWSFQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |