C24H31N3O4 — CID 55853763
N-[2-(cyclohexanecarbonylamino)ethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 55853763) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[2-(cyclohexanecarbonylamino)ethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[2-(cyclohexanecarbonylamino)ethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55853763 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-[2-(cyclohexanecarbonylamino)ethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCCNC(=O)C2CCCCC2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C24H31N3O4/c1-2-30-22-15-20(10-11-21(22)31-17-18-7-6-12-25-16-18)24(29)27-14-13-26-23(28)19-8-4-3-5-9-19/h6-7,10-12,15-16,19H,2-5,8-9,13-14,17H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | XAORBNPZUUQWNW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|