C27H33N3O3 — CID 46671493
N-[[2-(diethylaminomethyl)phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 46671493) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[[2-(diethylaminomethyl)phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46671493 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-[[2-(diethylaminomethyl)phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccccc2CN(CC)CC)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C27H33N3O3/c1-4-30(5-2)19-24-12-8-7-11-23(24)18-29-27(31)22-13-14-25(26(16-22)32-6-3)33-20-21-10-9-15-28-17-21/h7-17H,4-6,18-20H2,1-3H3,(H,29,31) |
| InChIKey | LRTKQFLYLMDMHS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |