C28H35N3O4 — CID 55715428
N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 55715428) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 55715428 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[[2-[2-(diethylamino)ethoxy]phenyl]methyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCc2ccccc2OCCN(CC)CC)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C28H35N3O4/c1-4-31(5-2)16-17-34-25-12-8-7-11-24(25)20-30-28(32)23-13-14-26(27(18-23)33-6-3)35-21-22-10-9-15-29-19-22/h7-15,18-19H,4-6,16-17,20-21H2,1-3H3,(H,30,32) |
| InChIKey | KLQLVYRPANAWOQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |