C22H29N3O3 — CID 119556374
3-ethoxy-N-(2-piperidin-3-ylethyl)-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 119556374) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-ethoxy-N-(2-piperidin-3-ylethyl)-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | 3-ethoxy-N-(2-piperidin-3-ylethyl)-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 119556374 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-ethoxy-N-(2-piperidin-3-ylethyl)-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCCC2CCCNC2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C22H29N3O3/c1-2-27-21-13-19(22(26)25-12-9-17-5-3-10-23-14-17)7-8-20(21)28-16-18-6-4-11-24-15-18/h4,6-8,11,13,15,17,23H,2-3,5,9-10,12,14,16H2,1H3,(H,25,26) |
| InChIKey | VQRBEEGMRRGRBL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |