C27H30ClN3O3 — CID 46584040
N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide (PubChem CID 46584040) has the molecular formula C27H30ClN3O3 and a molecular weight of 480.01 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46584040 |
| Molecular Formula | C27H30ClN3O3 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-ethoxy-4-(pyridin-3-ylmethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)NCC(c2ccccc2Cl)N2CCCC2)ccc1OCc1cccnc1 |
| InChI | InChI=1S/C27H30ClN3O3/c1-2-33-26-16-21(11-12-25(26)34-19-20-8-7-13-29-17-20)27(32)30-18-24(31-14-5-6-15-31)22-9-3-4-10-23(22)28/h3-4,7-13,16-17,24H,2,5-6,14-15,18-19H2,1H3,(H,30,32) |
| InChIKey | IYTNXADJPLMFNY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |