C17H25N3O4 — CID 94024269
2-methoxy-N-[(2R)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyridine-3-carboxamide (PubChem CID 94024269) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-methoxy-N-[(2R)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyridine-3-carboxamide.
| Compound Name | 2-methoxy-N-[(2R)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 94024269 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-methoxy-N-[(2R)-2-morpholin-4-yl-2-[(3S)-oxolan-3-yl]ethyl]pyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)NC[C@@H]([C@@H]1CCOC1)N1CCOCC1 |
| InChI | InChI=1S/C17H25N3O4/c1-22-17-14(3-2-5-18-17)16(21)19-11-15(13-4-8-24-12-13)20-6-9-23-10-7-20/h2-3,5,13,15H,4,6-12H2,1H3,(H,19,21)/t13-,15+/m1/s1 |
| InChIKey | MEOFZYWBMXYOHI-HIFRSBDPSA-N |
| XLogP | 0.56 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |